C29H36N6O3S — CID 146413376
6-[amino(cyclopropyl)amino]-2-methyl-3-[[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]methyl]aniline (PubChem CID 146413376) has the molecular formula C29H36N6O3S and a molecular weight of 548.71 g/mol. Its IUPAC name is 6-[amino(cyclopropyl)amino]-2-methyl-3-[[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]methyl]aniline.
| Compound Name | 6-[amino(cyclopropyl)amino]-2-methyl-3-[[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]methyl]aniline |
|---|---|
| PubChem CID | 146413376 |
| Molecular Formula | C29H36N6O3S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 6-[amino(cyclopropyl)amino]-2-methyl-3-[[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]methyl]aniline |
| SMILES | Cc1ncc(Cc2ccc(N(N)C3CC3)c(N)c2C)cc1CN1CC2(CCOCC2)Oc2ncccc2S1=O |
| InChI | InChI=1S/C29H36N6O3S/c1-19-22(5-8-25(27(19)30)35(31)24-6-7-24)14-21-15-23(20(2)33-16-21)17-34-18-29(9-12-37-13-10-29)38-28-26(39(34)36)4-3-11-32-28/h3-5,8,11,15-16,24H,6-7,9-10,12-14,17-18,30-31H2,1-2H3 |
| InChIKey | WXBRRCHFSJZWQI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|