C33H42N6O5S — CID 146413379
3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]propanoic acid (PubChem CID 146413379) has the molecular formula C33H42N6O5S and a molecular weight of 634.80 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 146413379 |
| Molecular Formula | C33H42N6O5S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.29 |
| IUPAC Name | 3-[3-amino-4-[amino(cyclopropyl)amino]-2-methylphenyl]-2,2-dimethyl-3-[6-methyl-5-[(1-oxospiro[3H-pyrido[2,3-b][1,4,5]oxathiazepine-4,4'-oxane]-2-yl)methyl]-3-pyridinyl]propanoic acid |
| SMILES | Cc1ncc(C(c2ccc(N(N)C3CC3)c(N)c2C)C(C)(C)C(=O)O)cc1CN1CC2(CCOCC2)Oc2ncccc2S1=O |
| InChI | InChI=1S/C33H42N6O5S/c1-20-25(9-10-26(29(20)34)39(35)24-7-8-24)28(32(3,4)31(40)41)22-16-23(21(2)37-17-22)18-38-19-33(11-14-43-15-12-33)44-30-27(45(38)42)6-5-13-36-30/h5-6,9-10,13,16-17,24,28H,7-8,11-12,14-15,18-19,34-35H2,1-4H3,(H,40,41) |
| InChIKey | IVVAALJEEDZPOH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|