C16H22FNO4 — CID 146414601
2-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-1-(1-hydroxyethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-4-yl]propan-2-ol (PubChem CID 146414601) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is 2-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-1-(1-hydroxyethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-4-yl]propan-2-ol.
| Compound Name | 2-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-1-(1-hydroxyethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 146414601 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-1-(1-hydroxyethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-4-yl]propan-2-ol |
| SMILES | CC(O)N1OC[C@@H]2[C@@H](C(C)(C)O)OC[C@@]21c1ccccc1F |
| InChI | InChI=1S/C16H22FNO4/c1-10(19)18-16(11-6-4-5-7-13(11)17)9-21-14(15(2,3)20)12(16)8-22-18/h4-7,10,12,14,19-20H,8-9H2,1-3H3/t10?,12-,14+,16-/m1/s1 |
| InChIKey | GBJROEWMCNHCGE-MGDJYWQKSA-N |
| XLogP | 1.39 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |