C14H18FNO4 — CID 146414739
1-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-4-(hydroxymethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]ethanol (PubChem CID 146414739) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-4-(hydroxymethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]ethanol.
| Compound Name | 1-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-4-(hydroxymethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]ethanol |
|---|---|
| PubChem CID | 146414739 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[(3aR,4S,6aS)-6a-(2-fluorophenyl)-4-(hydroxymethyl)-3,3a,4,6-tetrahydrofuro[3,4-c][1,2]oxazol-1-yl]ethanol |
| SMILES | CC(O)N1OC[C@@H]2[C@@H](CO)OC[C@@]21c1ccccc1F |
| InChI | InChI=1S/C14H18FNO4/c1-9(18)16-14(10-4-2-3-5-12(10)15)8-19-13(6-17)11(14)7-20-16/h2-5,9,11,13,17-18H,6-8H2,1H3/t9?,11-,13-,14-/m1/s1 |
| InChIKey | UUDCTZSXKBUTDQ-ZJIBQARXSA-N |
| XLogP | 0.61 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |