C22H28N6O3S — CID 146415285
N-[5-[(1S)-1-[3-[(2,6-dimethyl-4-pyridinyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 146415285) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[5-[(1S)-1-[3-[(2,6-dimethyl-4-pyridinyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[(1S)-1-[3-[(2,6-dimethyl-4-pyridinyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 146415285 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | N-[5-[(1S)-1-[3-[(2,6-dimethyl-4-pyridinyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]ethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc([C@H](C)N2CCC3(CC2)NC(=O)N(Cc2cc(C)nc(C)c2)C3=O)s1 |
| InChI | InChI=1S/C22H28N6O3S/c1-13-9-17(10-14(2)24-13)12-28-19(30)22(26-21(28)31)5-7-27(8-6-22)15(3)18-11-23-20(32-18)25-16(4)29/h9-11,15H,5-8,12H2,1-4H3,(H,26,31)(H,23,25,29)/t15-/m0/s1 |
| InChIKey | FQHVGPWJZJLYQN-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|