C20H20N6O2S — CID 146415372
8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-pyrimidin-5-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 146415372) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is 8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-pyrimidin-5-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-pyrimidin-5-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 146415372 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 8-[1-(1,3-benzothiazol-5-yl)ethyl]-3-pyrimidin-5-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(c1ccc2scnc2c1)N1CCC2(CC1)NC(=O)N(c1cncnc1)C2=O |
| InChI | InChI=1S/C20H20N6O2S/c1-13(14-2-3-17-16(8-14)23-12-29-17)25-6-4-20(5-7-25)18(27)26(19(28)24-20)15-9-21-11-22-10-15/h2-3,8-13H,4-7H2,1H3,(H,24,28) |
| InChIKey | BFUWZIZZVNVQHZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|