C13H25NS — CID 146415610
(1E,3Z)-1-amino-4,6,8-trimethyldeca-1,3-diene-1-thiol (PubChem CID 146415610) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is (1E,3Z)-1-amino-4,6,8-trimethyldeca-1,3-diene-1-thiol.
| Compound Name | (1E,3Z)-1-amino-4,6,8-trimethyldeca-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 146415610 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (1E,3Z)-1-amino-4,6,8-trimethyldeca-1,3-diene-1-thiol |
| SMILES | CCC(C)CC(C)C/C(C)=C\C=C(/N)S |
| InChI | InChI=1S/C13H25NS/c1-5-10(2)8-12(4)9-11(3)6-7-13(14)15/h6-7,10,12,15H,5,8-9,14H2,1-4H3/b11-6-,13-7+ |
| InChIKey | LLZJBSQJYDQXBW-LPBBVNJDSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|