About methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate
methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate (PubChem CID 146415646) has the molecular formula C22H23NO5
and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate.
Molecular Properties
| Compound Name | methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate |
| PubChem CID | 146415646 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate |
| SMILES | COC(=O)C1=C(O)c2c(-c3ccc(OC)cc3)ccn2C2(CCCCC2)C1=O |
| InChI | InChI=1S/C22H23NO5/c1-27-15-8-6-14(7-9-15)16-10-13-23-18(16)19(24)17(21(26)28-2)20(25)22(23)11-4-3-5-12-22/h6-10,13,24H,3-5,11-12H2,1-2H3 |
| InChIKey | KIZVMDGWNJPOHG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate?
The IUPAC name of methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate (CID 146415646) is methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate.
What is the SMILES notation for methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate?
The canonical SMILES for methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate is COC(=O)C1=C(O)c2c(-c3ccc(OC)cc3)ccn2C2(CCCCC2)C1=O.
What is the InChIKey of methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate?
The InChIKey is KIZVMDGWNJPOHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO5/c1-27-15-8-6-14(7-9-15)16-10-13-23-18(16)19(24)17(21(26)28-2)20(25)22(23)11-4-3-5-12-22/h6-10,13,24H,3-5,11-12H2,1-2H3.
What are the key properties of methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate?
methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate has a molecular weight of 381.43 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8'-hydroxy-1'-(4-methoxyphenyl)-6'-oxospiro[cyclohexane-1,5'-indolizine]-7'-carboxylate is sourced from PubChem (CID 146415646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).