C30H33N7O4 — CID 146416368
(11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-11-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide (PubChem CID 146416368) has the molecular formula C30H33N7O4 and a molecular weight of 555.64 g/mol. Its IUPAC name is (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-11-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide.
| Compound Name | (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-11-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 146416368 |
| Molecular Formula | C30H33N7O4 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (11S)-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-11-[4-[[(E)-3-phenylprop-2-enoyl]amino]butyl]-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)cc3c2n1[C@@H](CCCCNC(=O)/C=C/c1ccccc1)CO3 |
| InChI | InChI=1S/C30H33N7O4/c1-3-36-24(15-19(2)35-36)29(40)34-30-33-23-16-21(28(31)39)17-25-27(23)37(30)22(18-41-25)11-7-8-14-32-26(38)13-12-20-9-5-4-6-10-20/h4-6,9-10,12-13,15-17,22H,3,7-8,11,14,18H2,1-2H3,(H2,31,39)(H,32,38)(H,33,34,40)/b13-12+/t22-/m0/s1 |
| InChIKey | CPEZVUVVXVTJMV-GNNUASRNSA-N |
| XLogP | 3.85 |
| TPSA | 146.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|