About 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine
5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine (PubChem CID 146416395) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine |
| PubChem CID | 146416395 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine |
| SMILES | C=C(CCC)NC1=NCCC=C1C |
| InChI | InChI=1S/C11H18N2/c1-4-6-10(3)13-11-9(2)7-5-8-12-11/h7H,3-6,8H2,1-2H3,(H,12,13) |
| InChIKey | AXHYVFAYXNHNED-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine?
The IUPAC name of 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine (CID 146416395) is 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine.
What is the SMILES notation for 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine?
The canonical SMILES for 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine is C=C(CCC)NC1=NCCC=C1C.
What is the InChIKey of 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine?
The InChIKey is AXHYVFAYXNHNED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-6-10(3)13-11-9(2)7-5-8-12-11/h7H,3-6,8H2,1-2H3,(H,12,13).
What are the key properties of 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine?
5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine has a molecular weight of 178.28 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-pent-1-en-2-yl-2,3-dihydropyridin-6-amine is sourced from PubChem (CID 146416395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).