C16H27NO2 — CID 146416580
ethyl 3-[(4R)-2-butyl-1,3-dimethyl-5,6-didehydro-3,4-dihydro-2H-pyridin-4-yl]propanoate (PubChem CID 146416580) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is ethyl 3-[(4R)-2-butyl-1,3-dimethyl-5,6-didehydro-3,4-dihydro-2H-pyridin-4-yl]propanoate.
| Compound Name | ethyl 3-[(4R)-2-butyl-1,3-dimethyl-5,6-didehydro-3,4-dihydro-2H-pyridin-4-yl]propanoate |
|---|---|
| PubChem CID | 146416580 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | ethyl 3-[(4R)-2-butyl-1,3-dimethyl-5,6-didehydro-3,4-dihydro-2H-pyridin-4-yl]propanoate |
| SMILES | CCCCC1C(C)[C@@H](CCC(=O)OCC)C#CN1C |
| InChI | InChI=1S/C16H27NO2/c1-5-7-8-15-13(3)14(11-12-17(15)4)9-10-16(18)19-6-2/h13-15H,5-10H2,1-4H3/t13?,14-,15?/m0/s1 |
| InChIKey | HKCYZPPGWHGCKT-SLTAFYQDSA-N |
| XLogP | 3.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|