About N-but-1-en-2-yl-4H-1,3-diazepin-6-amine
N-but-1-en-2-yl-4H-1,3-diazepin-6-amine (PubChem CID 146416593) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is N-but-1-en-2-yl-4H-1,3-diazepin-6-amine.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-4H-1,3-diazepin-6-amine |
| PubChem CID | 146416593 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N-but-1-en-2-yl-4H-1,3-diazepin-6-amine |
| SMILES | C=C(CC)NC1=CCN=CN=C1 |
| InChI | InChI=1S/C9H13N3/c1-3-8(2)12-9-4-5-10-7-11-6-9/h4,6-7,12H,2-3,5H2,1H3 |
| InChIKey | ZWRNASIPYCNARK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-but-1-en-2-yl-4H-1,3-diazepin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-4H-1,3-diazepin-6-amine?
The IUPAC name of N-but-1-en-2-yl-4H-1,3-diazepin-6-amine (CID 146416593) is N-but-1-en-2-yl-4H-1,3-diazepin-6-amine.
What is the SMILES notation for N-but-1-en-2-yl-4H-1,3-diazepin-6-amine?
The canonical SMILES for N-but-1-en-2-yl-4H-1,3-diazepin-6-amine is C=C(CC)NC1=CCN=CN=C1.
What is the InChIKey of N-but-1-en-2-yl-4H-1,3-diazepin-6-amine?
The InChIKey is ZWRNASIPYCNARK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-3-8(2)12-9-4-5-10-7-11-6-9/h4,6-7,12H,2-3,5H2,1H3.
What are the key properties of N-but-1-en-2-yl-4H-1,3-diazepin-6-amine?
N-but-1-en-2-yl-4H-1,3-diazepin-6-amine has a molecular weight of 163.22 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-4H-1,3-diazepin-6-amine is sourced from PubChem (CID 146416593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).