C11H18N2O2 — CID 146416629
N-[(2Z,4Z)-2-amino-6-methoxyhepta-2,4,6-trienyl]propanamide (PubChem CID 146416629) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-amino-6-methoxyhepta-2,4,6-trienyl]propanamide.
| Compound Name | N-[(2Z,4Z)-2-amino-6-methoxyhepta-2,4,6-trienyl]propanamide |
|---|---|
| PubChem CID | 146416629 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-[(2Z,4Z)-2-amino-6-methoxyhepta-2,4,6-trienyl]propanamide |
| SMILES | C=C(/C=C\C=C(/N)CNC(=O)CC)OC |
| InChI | InChI=1S/C11H18N2O2/c1-4-11(14)13-8-10(12)7-5-6-9(2)15-3/h5-7H,2,4,8,12H2,1,3H3,(H,13,14)/b6-5-,10-7- |
| InChIKey | WHDZOYCEDKZNGN-ICZHLNMZSA-N |
| XLogP | 1.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|