About N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine
N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine (PubChem CID 146416732) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine |
| PubChem CID | 146416732 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine |
| SMILES | C=C(CC)NC1=NCCC(C)=C1 |
| InChI | InChI=1S/C10H16N2/c1-4-9(3)12-10-7-8(2)5-6-11-10/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | FNOGGRXJLFNTSI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine?
The IUPAC name of N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine (CID 146416732) is N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine.
What is the SMILES notation for N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine?
The canonical SMILES for N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine is C=C(CC)NC1=NCCC(C)=C1.
What is the InChIKey of N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine?
The InChIKey is FNOGGRXJLFNTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-4-9(3)12-10-7-8(2)5-6-11-10/h7H,3-6H2,1-2H3,(H,11,12).
What are the key properties of N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine?
N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine has a molecular weight of 164.25 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-yl-4-methyl-2,3-dihydropyridin-6-amine is sourced from PubChem (CID 146416732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).