C13H19NO — CID 146416812
3-[(3Z,7Z)-1,5-dimethyl-6-methylidene-2,5-dihydroazocin-7-yl]propanal (PubChem CID 146416812) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 3-[(3Z,7Z)-1,5-dimethyl-6-methylidene-2,5-dihydroazocin-7-yl]propanal.
| Compound Name | 3-[(3Z,7Z)-1,5-dimethyl-6-methylidene-2,5-dihydroazocin-7-yl]propanal |
|---|---|
| PubChem CID | 146416812 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 3-[(3Z,7Z)-1,5-dimethyl-6-methylidene-2,5-dihydroazocin-7-yl]propanal |
| SMILES | C=C1/C(CCC=O)=C\N(C)C/C=C\C1C |
| InChI | InChI=1S/C13H19NO/c1-11-6-4-8-14(3)10-13(12(11)2)7-5-9-15/h4,6,9-11H,2,5,7-8H2,1,3H3/b6-4-,13-10- |
| InChIKey | BZLVBLKLCSXQGT-QGIBGKBZSA-N |
| XLogP | 2.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|