C27H34FN3O3 — CID 146417196
2-(2-cyclopropylphenyl)-2-[3-fluoro-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417196) has the molecular formula C27H34FN3O3 and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-(2-cyclopropylphenyl)-2-[3-fluoro-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclopropylphenyl)-2-[3-fluoro-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417196 |
| Molecular Formula | C27H34FN3O3 |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-(2-cyclopropylphenyl)-2-[3-fluoro-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1ccccc1C1CC1)N1CC(F)C(OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C27H34FN3O3/c28-23-16-31(25(27(32)33)22-9-2-1-8-21(22)18-10-11-18)17-24(23)34-15-4-3-7-20-13-12-19-6-5-14-29-26(19)30-20/h1-2,8-9,12-13,18,23-25H,3-7,10-11,14-17H2,(H,29,30)(H,32,33) |
| InChIKey | QHMMZOKWGDLZLQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|