C30H38F3N3O5 — CID 146417206
2-[2-(5,5-difluorooxan-2-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417206) has the molecular formula C30H38F3N3O5 and a molecular weight of 577.64 g/mol. Its IUPAC name is 2-[2-(5,5-difluorooxan-2-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(5,5-difluorooxan-2-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417206 |
| Molecular Formula | C30H38F3N3O5 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 2-[2-(5,5-difluorooxan-2-yl)-5-fluorophenyl]-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCO[C@@H]2CCN(C(C(=O)O)c3cc(F)ccc3C3CCC(F)(F)CO3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C30H38F3N3O5/c1-39-26-16-20(35-28-23(26)6-4-12-34-28)5-2-3-14-40-21-10-13-36(17-21)27(29(37)38)24-15-19(31)7-8-22(24)25-9-11-30(32,33)18-41-25/h7-8,15-16,21,25,27H,2-6,9-14,17-18H2,1H3,(H,34,35)(H,37,38)/t21-,25?,27?/m1/s1 |
| InChIKey | BFHVMECHESYUJB-KYDWWNIQSA-N |
| XLogP | 5.31 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|