C28H36FN3O5 — CID 146417258
2-(2-cyclopropyloxy-5-fluorophenyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417258) has the molecular formula C28H36FN3O5 and a molecular weight of 513.61 g/mol. Its IUPAC name is 2-(2-cyclopropyloxy-5-fluorophenyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclopropyloxy-5-fluorophenyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417258 |
| Molecular Formula | C28H36FN3O5 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 2-(2-cyclopropyloxy-5-fluorophenyl)-2-[(3R)-3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCO[C@@H]2CCN(C(C(=O)O)c3cc(F)ccc3OC3CC3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C28H36FN3O5/c1-35-25-16-19(31-27-22(25)6-4-12-30-27)5-2-3-14-36-21-11-13-32(17-21)26(28(33)34)23-15-18(29)7-10-24(23)37-20-8-9-20/h7,10,15-16,20-21,26H,2-6,8-9,11-14,17H2,1H3,(H,30,31)(H,33,34)/t21-,26?/m1/s1 |
| InChIKey | BSAAUGZNWPWTHT-OSMGYRLQSA-N |
| XLogP | 4.37 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|