C28H39FN4O3 — CID 146417277
2-[2-(3-fluoro-3-methylbutyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417277) has the molecular formula C28H39FN4O3 and a molecular weight of 498.64 g/mol. Its IUPAC name is 2-[2-(3-fluoro-3-methylbutyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(3-fluoro-3-methylbutyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417277 |
| Molecular Formula | C28H39FN4O3 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 2-[2-(3-fluoro-3-methylbutyl)-3-pyridinyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CC(C)(F)CCc1ncccc1C(C(=O)O)N1CC[C@@H](OCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C28H39FN4O3/c1-28(2,29)14-12-24-23(9-6-15-30-24)25(27(34)35)33-17-13-22(19-33)36-18-4-3-8-21-11-10-20-7-5-16-31-26(20)32-21/h6,9-11,15,22,25H,3-5,7-8,12-14,16-19H2,1-2H3,(H,31,32)(H,34,35)/t22-,25?/m1/s1 |
| InChIKey | IWQYPWSSQPOIOZ-UFUCKMQHSA-N |
| XLogP | 4.75 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|