C30H40FN3O6 — CID 146417354
2-[3-fluoro-2-[(3-methyloxetan-3-yl)oxymethyl]phenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417354) has the molecular formula C30H40FN3O6 and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-[3-fluoro-2-[(3-methyloxetan-3-yl)oxymethyl]phenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[3-fluoro-2-[(3-methyloxetan-3-yl)oxymethyl]phenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417354 |
| Molecular Formula | C30H40FN3O6 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 2-[3-fluoro-2-[(3-methyloxetan-3-yl)oxymethyl]phenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCOC2CCN(C(C(=O)O)c3cccc(F)c3COC3(C)COC3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C30H40FN3O6/c1-30(18-38-19-30)40-17-24-22(8-5-10-25(24)31)27(29(35)36)34-13-11-21(16-34)39-14-4-3-7-20-15-26(37-2)23-9-6-12-32-28(23)33-20/h5,8,10,15,21,27H,3-4,6-7,9,11-14,16-19H2,1-2H3,(H,32,33)(H,35,36) |
| InChIKey | FHUWAKTVICLSKG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|