C27H35F2N3O3 — CID 146417449
2-[2-(1,1-difluoroethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417449) has the molecular formula C27H35F2N3O3 and a molecular weight of 487.59 g/mol. Its IUPAC name is 2-[2-(1,1-difluoroethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(1,1-difluoroethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417449 |
| Molecular Formula | C27H35F2N3O3 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-[2-(1,1-difluoroethyl)phenyl]-2-[3-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | CC(F)(F)c1ccccc1C(C(=O)O)N1CCC(OCCCCCc2ccc3c(n2)NCCC3)C1 |
| InChI | InChI=1S/C27H35F2N3O3/c1-27(28,29)23-11-5-4-10-22(23)24(26(33)34)32-16-14-21(18-32)35-17-6-2-3-9-20-13-12-19-8-7-15-30-25(19)31-20/h4-5,10-13,21,24H,2-3,6-9,14-18H2,1H3,(H,30,31)(H,33,34) |
| InChIKey | RRZSNGLLJKRGMK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|