C31H42FN3O5 — CID 146417476
2-[5-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417476) has the molecular formula C31H42FN3O5 and a molecular weight of 555.69 g/mol. Its IUPAC name is 2-[5-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[5-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417476 |
| Molecular Formula | C31H42FN3O5 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.31 |
| IUPAC Name | 2-[5-fluoro-2-(oxan-2-yl)phenyl]-2-[3-[4-(4-methoxy-7-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCOC2CCN(C(C(=O)O)c3cc(F)ccc3C3CCCCO3)C2)nc2c1CCC(C)N2 |
| InChI | InChI=1S/C31H42FN3O5/c1-20-9-11-25-28(38-2)18-22(34-30(25)33-20)7-3-5-15-39-23-13-14-35(19-23)29(31(36)37)26-17-21(32)10-12-24(26)27-8-4-6-16-40-27/h10,12,17-18,20,23,27,29H,3-9,11,13-16,19H2,1-2H3,(H,33,34)(H,36,37) |
| InChIKey | MEOSAUNYQXZHCM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|