C32H44FN3O5 — CID 146417483
2-[2-(5,5-dimethyloxan-2-yl)-5-fluorophenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 146417483) has the molecular formula C32H44FN3O5 and a molecular weight of 569.72 g/mol. Its IUPAC name is 2-[2-(5,5-dimethyloxan-2-yl)-5-fluorophenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(5,5-dimethyloxan-2-yl)-5-fluorophenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 146417483 |
| Molecular Formula | C32H44FN3O5 |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | 2-[2-(5,5-dimethyloxan-2-yl)-5-fluorophenyl]-2-[3-[4-(4-methoxy-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | COc1cc(CCCCOC2CCN(C(C(=O)O)c3cc(F)ccc3C3CCC(C)(C)CO3)C2)nc2c1CCCN2 |
| InChI | InChI=1S/C32H44FN3O5/c1-32(2)13-11-27(41-20-32)24-10-9-21(33)17-26(24)29(31(37)38)36-15-12-23(19-36)40-16-5-4-7-22-18-28(39-3)25-8-6-14-34-30(25)35-22/h9-10,17-18,23,27,29H,4-8,11-16,19-20H2,1-3H3,(H,34,35)(H,37,38) |
| InChIKey | JZZIGEVEVZZPKL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|