About 4-butylquinoline
4-butylquinoline (PubChem CID 14641784) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-butylquinoline.
Molecular Properties
| Compound Name | 4-butylquinoline |
| PubChem CID | 14641784 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-butylquinoline |
| SMILES | CCCCc1ccnc2ccccc12 |
| InChI | InChI=1S/C13H15N/c1-2-3-6-11-9-10-14-13-8-5-4-7-12(11)13/h4-5,7-10H,2-3,6H2,1H3 |
| InChIKey | MTSCTQMKKVEJHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylquinoline?
The IUPAC name of 4-butylquinoline (CID 14641784) is 4-butylquinoline.
What is the SMILES notation for 4-butylquinoline?
The canonical SMILES for 4-butylquinoline is CCCCc1ccnc2ccccc12.
What is the InChIKey of 4-butylquinoline?
The InChIKey is MTSCTQMKKVEJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-2-3-6-11-9-10-14-13-8-5-4-7-12(11)13/h4-5,7-10H,2-3,6H2,1H3.
What are the key properties of 4-butylquinoline?
4-butylquinoline has a molecular weight of 185.27 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylquinoline is sourced from PubChem (CID 14641784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).