C14H22 — CID 14641811
1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane (PubChem CID 14641811) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane |
|---|---|
| PubChem CID | 14641811 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane |
| SMILES | CCCC1(C2=CC=CC2)CCCCC1 |
| InChI | InChI=1S/C14H22/c1-2-10-14(11-6-3-7-12-14)13-8-4-5-9-13/h4-5,8H,2-3,6-7,9-12H2,1H3 |
| InChIKey | WIHQIXXLPNEQCL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |