About 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane
1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane (PubChem CID 14641811) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane.
Molecular Properties
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane |
| PubChem CID | 14641811 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane |
| SMILES | CCCC1(C2=CC=CC2)CCCCC1 |
| InChI | InChI=1S/C14H22/c1-2-10-14(11-6-3-7-12-14)13-8-4-5-9-13/h4-5,8H,2-3,6-7,9-12H2,1H3 |
| InChIKey | WIHQIXXLPNEQCL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane?
The IUPAC name of 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane (CID 14641811) is 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane.
What is the SMILES notation for 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane?
The canonical SMILES for 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane is CCCC1(C2=CC=CC2)CCCCC1.
What is the InChIKey of 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane?
The InChIKey is WIHQIXXLPNEQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-2-10-14(11-6-3-7-12-14)13-8-4-5-9-13/h4-5,8H,2-3,6-7,9-12H2,1H3.
What are the key properties of 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane?
1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane has a molecular weight of 190.33 g/mol, XLogP of 4.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,3-dien-1-yl-1-propylcyclohexane is sourced from PubChem (CID 14641811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).