C20H21N5O — CID 146418340
1-ethanimidoyl-1-(1-phenylethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea (PubChem CID 146418340) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-ethanimidoyl-1-(1-phenylethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea.
| Compound Name | 1-ethanimidoyl-1-(1-phenylethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 146418340 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-ethanimidoyl-1-(1-phenylethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea |
| SMILES | [H]/N=C(\C)N(C(=O)Nc1ccc(-c2cn[nH]c2)cc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C20H21N5O/c1-14(16-6-4-3-5-7-16)25(15(2)21)20(26)24-19-10-8-17(9-11-19)18-12-22-23-13-18/h3-14,21H,1-2H3,(H,22,23)(H,24,26)/b21-15+ |
| InChIKey | VOPWLXYPXPZLQN-RCCKNPSSSA-N |
| XLogP | 4.67 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|