C39H60N4O2 — CID 146420125
(Z,2E)-2-[1-[(N-ethyl-C-methylcarbonimidoyl)amino]ethylidene]-4-methyl-N-[3-[3-methyl-1-[methyl(2-phenylethyl)amino]butan-2-yl]oxyphenyl]-N-(3-methylpentyl)hex-3-enamide (PubChem CID 146420125) has the molecular formula C39H60N4O2 and a molecular weight of 616.93 g/mol. Its IUPAC name is (Z,2E)-2-[1-[(N-ethyl-C-methylcarbonimidoyl)amino]ethylidene]-4-methyl-N-[3-[3-methyl-1-[methyl(2-phenylethyl)amino]butan-2-yl]oxyphenyl]-N-(3-methylpentyl)hex-3-enamide.
| Compound Name | (Z,2E)-2-[1-[(N-ethyl-C-methylcarbonimidoyl)amino]ethylidene]-4-methyl-N-[3-[3-methyl-1-[methyl(2-phenylethyl)amino]butan-2-yl]oxyphenyl]-N-(3-methylpentyl)hex-3-enamide |
|---|---|
| PubChem CID | 146420125 |
| Molecular Formula | C39H60N4O2 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.47 |
| IUPAC Name | (Z,2E)-2-[1-[(N-ethyl-C-methylcarbonimidoyl)amino]ethylidene]-4-methyl-N-[3-[3-methyl-1-[methyl(2-phenylethyl)amino]butan-2-yl]oxyphenyl]-N-(3-methylpentyl)hex-3-enamide |
| SMILES | CC/N=C(\C)N/C(C)=C(\C=C(\C)CC)C(=O)N(CCC(C)CC)c1cccc(OC(CN(C)CCc2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C39H60N4O2/c1-11-30(6)22-25-43(39(44)37(26-31(7)12-2)32(8)41-33(9)40-13-3)35-20-17-21-36(27-35)45-38(29(4)5)28-42(10)24-23-34-18-15-14-16-19-34/h14-21,26-27,29-30,38H,11-13,22-25,28H2,1-10H3,(H,40,41)/b31-26-,37-32+ |
| InChIKey | IEILBOANXIFHKT-SCRVJRIKSA-N |
| XLogP | 8.69 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|