About (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine
(2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine (PubChem CID 146420145) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine |
| PubChem CID | 146420145 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine |
| SMILES | [H]/N=C/C(NCC)=C(\C=N\C)C(=C)C |
| InChI | InChI=1S/C10H17N3/c1-5-13-10(6-11)9(7-12-4)8(2)3/h6-7,11,13H,2,5H2,1,3-4H3/b10-9-,11-6+,12-7+ |
| InChIKey | QWHBGQWMBPGDIB-OMYMUDTISA-N |
| XLogP | 1.78 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine?
The IUPAC name of (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine (CID 146420145) is (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine?
The canonical SMILES for (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine is [H]/N=C/C(NCC)=C(\C=N\C)C(=C)C.
What is the InChIKey of (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine?
The InChIKey is QWHBGQWMBPGDIB-OMYMUDTISA-N. The full InChI is InChI=1S/C10H17N3/c1-5-13-10(6-11)9(7-12-4)8(2)3/h6-7,11,13H,2,5H2,1,3-4H3/b10-9-,11-6+,12-7+.
What are the key properties of (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine?
(2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine has a molecular weight of 179.27 g/mol, XLogP of 1.78, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-ethyl-1-imino-4-methyl-3-(methyliminomethyl)penta-2,4-dien-2-amine is sourced from PubChem (CID 146420145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).