C12H22N2O — CID 146420227
(1E,3E)-1-butan-2-yloxy-2,5-dimethylhexa-1,3,5-triene-1,4-diamine (PubChem CID 146420227) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (1E,3E)-1-butan-2-yloxy-2,5-dimethylhexa-1,3,5-triene-1,4-diamine.
| Compound Name | (1E,3E)-1-butan-2-yloxy-2,5-dimethylhexa-1,3,5-triene-1,4-diamine |
|---|---|
| PubChem CID | 146420227 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (1E,3E)-1-butan-2-yloxy-2,5-dimethylhexa-1,3,5-triene-1,4-diamine |
| SMILES | C=C(C)/C(N)=C\C(C)=C(/N)OC(C)CC |
| InChI | InChI=1S/C12H22N2O/c1-6-10(5)15-12(14)9(4)7-11(13)8(2)3/h7,10H,2,6,13-14H2,1,3-5H3/b11-7+,12-9+ |
| InChIKey | UBQSTYGGLORVMF-HNWKWBPYSA-N |
| XLogP | 2.41 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|