C12H22N2 — CID 146420434
N'-ethyl-N'-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]ethane-1,2-diamine (PubChem CID 146420434) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N'-ethyl-N'-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 146420434 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N'-ethyl-N'-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]ethane-1,2-diamine |
| SMILES | C/C=C\C=C(/C=C\C)N(CC)CCN |
| InChI | InChI=1S/C12H22N2/c1-4-7-9-12(8-5-2)14(6-3)11-10-13/h4-5,7-9H,6,10-11,13H2,1-3H3/b7-4-,8-5-,12-9+ |
| InChIKey | HUXOTTCBCWKUCB-HEBQHIFJSA-N |
| XLogP | 2.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|