About 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine
7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine (PubChem CID 146420597) has the molecular formula C9H13FO
and a molecular weight of 156.20 g/mol. Its IUPAC name is 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine.
Molecular Properties
| Compound Name | 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine |
| PubChem CID | 146420597 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine |
| SMILES | CCC1=CC(CF)=CCCO1 |
| InChI | InChI=1S/C9H13FO/c1-2-9-6-8(7-10)4-3-5-11-9/h4,6H,2-3,5,7H2,1H3 |
| InChIKey | VKILIOPIGAQOJO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine?
The IUPAC name of 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine (CID 146420597) is 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine.
What is the SMILES notation for 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine?
The canonical SMILES for 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine is CCC1=CC(CF)=CCCO1.
What is the InChIKey of 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine?
The InChIKey is VKILIOPIGAQOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO/c1-2-9-6-8(7-10)4-3-5-11-9/h4,6H,2-3,5,7H2,1H3.
What are the key properties of 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine?
7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine has a molecular weight of 156.20 g/mol, XLogP of 2.60, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5-(fluoromethyl)-2,3-dihydrooxepine is sourced from PubChem (CID 146420597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).