C11H8N4O — CID 14642067
9-azido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one (PubChem CID 14642067) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is 9-azido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one.
| Compound Name | 9-azido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 14642067 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 9-azido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-11-one |
| SMILES | [N-]=[N+]=Nc1cc(=O)n2c3c(cccc13)CC2 |
| InChI | InChI=1S/C11H8N4O/c12-14-13-9-6-10(16)15-5-4-7-2-1-3-8(9)11(7)15/h1-3,6H,4-5H2 |
| InChIKey | JJIAADLGHVEBCP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|