C11H7N7O2 — CID 14642071
10,10-diazido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-9,11-dione (PubChem CID 14642071) has the molecular formula C11H7N7O2 and a molecular weight of 269.22 g/mol. Its IUPAC name is 10,10-diazido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-9,11-dione.
| Compound Name | 10,10-diazido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-9,11-dione |
|---|---|
| PubChem CID | 14642071 |
| Molecular Formula | C11H7N7O2 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 10,10-diazido-1-azatricyclo[6.3.1.04,12]dodeca-4(12),5,7-triene-9,11-dione |
| SMILES | [N-]=[N+]=NC1(N=[N+]=[N-])C(=O)c2cccc3c2N(CC3)C1=O |
| InChI | InChI=1S/C11H7N7O2/c12-16-14-11(15-17-13)9(19)7-3-1-2-6-4-5-18(8(6)7)10(11)20/h1-3H,4-5H2 |
| InChIKey | KSEGBHVRSMLIOP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 134.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|