About [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate
[2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate (PubChem CID 146420981) has the molecular formula C22H31NO3
and a molecular weight of 357.49 g/mol. Its IUPAC name is [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate |
| PubChem CID | 146420981 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate |
| SMILES | Cc1cc(C)c(OC(=O)C2CCCCC2)c(C2(C(N)=O)CCCCC2)c1 |
| InChI | InChI=1S/C22H31NO3/c1-15-13-16(2)19(26-20(24)17-9-5-3-6-10-17)18(14-15)22(21(23)25)11-7-4-8-12-22/h13-14,17H,3-12H2,1-2H3,(H2,23,25) |
| InChIKey | UIFCVLFSLWLOBV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate?
The IUPAC name of [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate (CID 146420981) is [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate.
What is the SMILES notation for [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate?
The canonical SMILES for [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate is Cc1cc(C)c(OC(=O)C2CCCCC2)c(C2(C(N)=O)CCCCC2)c1.
What is the InChIKey of [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate?
The InChIKey is UIFCVLFSLWLOBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO3/c1-15-13-16(2)19(26-20(24)17-9-5-3-6-10-17)18(14-15)22(21(23)25)11-7-4-8-12-22/h13-14,17H,3-12H2,1-2H3,(H2,23,25).
What are the key properties of [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate?
[2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate has a molecular weight of 357.49 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-carbamoylcyclohexyl)-4,6-dimethylphenyl] cyclohexanecarboxylate is sourced from PubChem (CID 146420981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).