C16H12N2O8 — CID 146421111
4,5-dimethoxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid (PubChem CID 146421111) has the molecular formula C16H12N2O8 and a molecular weight of 360.28 g/mol. Its IUPAC name is 4,5-dimethoxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid.
| Compound Name | 4,5-dimethoxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
|---|---|
| PubChem CID | 146421111 |
| Molecular Formula | C16H12N2O8 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4,5-dimethoxy-6H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
| SMILES | COc1c(OC)c2[nH]c(C(=O)O)cc(C(=O)O)c2c2nc(C(=O)O)cc12 |
| InChI | InChI=1S/C16H12N2O8/c1-25-12-6-4-8(16(23)24)17-10(6)9-5(14(19)20)3-7(15(21)22)18-11(9)13(12)26-2/h3-4,18H,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | FSACFVPWARKHNC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 159.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |