About 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal
3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal (PubChem CID 146421371) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal.
Molecular Properties
| Compound Name | 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal |
| PubChem CID | 146421371 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal |
| SMILES | CC(C)[C@@H]1CC=C(CCC=O)[C@H](C)C1 |
| InChI | InChI=1S/C13H22O/c1-10(2)13-7-6-12(5-4-8-14)11(3)9-13/h6,8,10-11,13H,4-5,7,9H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | BSHGQHLBYQQDBW-DGCLKSJQSA-N |
| XLogP | 3.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal?
The IUPAC name of 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal (CID 146421371) is 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal.
What is the SMILES notation for 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal?
The canonical SMILES for 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal is CC(C)[C@@H]1CC=C(CCC=O)[C@H](C)C1.
What is the InChIKey of 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal?
The InChIKey is BSHGQHLBYQQDBW-DGCLKSJQSA-N. The full InChI is InChI=1S/C13H22O/c1-10(2)13-7-6-12(5-4-8-14)11(3)9-13/h6,8,10-11,13H,4-5,7,9H2,1-3H3/t11-,13-/m1/s1.
What are the key properties of 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal?
3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal has a molecular weight of 194.32 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R,6R)-6-methyl-4-propan-2-ylcyclohexen-1-yl]propanal is sourced from PubChem (CID 146421371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).