About (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid
(5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid (PubChem CID 146421754) has the molecular formula C10H8BrN3O4S2
and a molecular weight of 378.23 g/mol. Its IUPAC name is (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid.
Molecular Properties
| Compound Name | (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid |
| PubChem CID | 146421754 |
| Molecular Formula | C10H8BrN3O4S2 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 376.91 |
| IUPAC Name | (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid |
| SMILES | Cc1cc(S(=O)(=O)N(C(=O)O)c2cscn2)ncc1Br |
| InChI | InChI=1S/C10H8BrN3O4S2/c1-6-2-9(12-3-7(6)11)20(17,18)14(10(15)16)8-4-19-5-13-8/h2-5H,1H3,(H,15,16) |
| InChIKey | LHLSMWPYBLXPGL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid?
The IUPAC name of (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid (CID 146421754) is (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid.
What is the SMILES notation for (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid?
The canonical SMILES for (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid is Cc1cc(S(=O)(=O)N(C(=O)O)c2cscn2)ncc1Br.
What is the InChIKey of (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid?
The InChIKey is LHLSMWPYBLXPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrN3O4S2/c1-6-2-9(12-3-7(6)11)20(17,18)14(10(15)16)8-4-19-5-13-8/h2-5H,1H3,(H,15,16).
What are the key properties of (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid?
(5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid has a molecular weight of 378.23 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-4-methyl-2-pyridinyl)sulfonyl-(1,3-thiazol-4-yl)carbamic acid is sourced from PubChem (CID 146421754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).