About 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline
5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline (PubChem CID 146422416) has the molecular formula C10H11BrF3NO
and a molecular weight of 298.10 g/mol. Its IUPAC name is 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline.
Molecular Properties
| Compound Name | 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline |
| PubChem CID | 146422416 |
| Molecular Formula | C10H11BrF3NO |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline |
| SMILES | CCOC(c1ccc(Br)cc1N)C(F)(F)F |
| InChI | InChI=1S/C10H11BrF3NO/c1-2-16-9(10(12,13)14)7-4-3-6(11)5-8(7)15/h3-5,9H,2,15H2,1H3 |
| InChIKey | BJORUZZEQSSOIJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline?
The IUPAC name of 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline (CID 146422416) is 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline.
What is the SMILES notation for 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline?
The canonical SMILES for 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline is CCOC(c1ccc(Br)cc1N)C(F)(F)F.
What is the InChIKey of 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline?
The InChIKey is BJORUZZEQSSOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrF3NO/c1-2-16-9(10(12,13)14)7-4-3-6(11)5-8(7)15/h3-5,9H,2,15H2,1H3.
What are the key properties of 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline?
5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline has a molecular weight of 298.10 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1-ethoxy-2,2,2-trifluoroethyl)aniline is sourced from PubChem (CID 146422416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).