About 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine
1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine (PubChem CID 146422697) has the molecular formula C19H22N8
and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine |
| PubChem CID | 146422697 |
| Molecular Formula | C19H22N8 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine |
| SMILES | CCCn1nnc(-c2ccc(C(N)(CN)c3ccc4nc[nH]c4c3)cc2)n1 |
| InChI | InChI=1S/C19H22N8/c1-2-9-27-25-18(24-26-27)13-3-5-14(6-4-13)19(21,11-20)15-7-8-16-17(10-15)23-12-22-16/h3-8,10,12H,2,9,11,20-21H2,1H3,(H,22,23) |
| InChIKey | WKXFHISDBRFOHY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine?
The IUPAC name of 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine (CID 146422697) is 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine.
What is the SMILES notation for 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine?
The canonical SMILES for 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine is CCCn1nnc(-c2ccc(C(N)(CN)c3ccc4nc[nH]c4c3)cc2)n1.
What is the InChIKey of 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine?
The InChIKey is WKXFHISDBRFOHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N8/c1-2-9-27-25-18(24-26-27)13-3-5-14(6-4-13)19(21,11-20)15-7-8-16-17(10-15)23-12-22-16/h3-8,10,12H,2,9,11,20-21H2,1H3,(H,22,23).
What are the key properties of 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine?
1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine has a molecular weight of 362.44 g/mol, XLogP of 1.79, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3H-benzimidazol-5-yl)-1-[4-(2-propyltetrazol-5-yl)phenyl]ethane-1,2-diamine is sourced from PubChem (CID 146422697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).