C13H14N6O2 — CID 14642377
ethyl (1E)-N-(5-methyl-8-oxo-2,4,6,7,10-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,10,12-pentaen-4-yl)ethanimidate (PubChem CID 14642377) has the molecular formula C13H14N6O2 and a molecular weight of 286.30 g/mol. Its IUPAC name is ethyl (1E)-N-(5-methyl-8-oxo-2,4,6,7,10-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,10,12-pentaen-4-yl)ethanimidate.
| Compound Name | ethyl (1E)-N-(5-methyl-8-oxo-2,4,6,7,10-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,10,12-pentaen-4-yl)ethanimidate |
|---|---|
| PubChem CID | 14642377 |
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl (1E)-N-(5-methyl-8-oxo-2,4,6,7,10-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,10,12-pentaen-4-yl)ethanimidate |
| SMILES | CCO/C(C)=N/n1c(C)nn2c(=O)c3ncccc3nc12 |
| InChI | InChI=1S/C13H14N6O2/c1-4-21-9(3)17-18-8(2)16-19-12(20)11-10(15-13(18)19)6-5-7-14-11/h5-7H,4H2,1-3H3/b17-9+ |
| InChIKey | XLNUQUOJJLLQFH-RQZCQDPDSA-N |
| XLogP | 0.97 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|