About (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol
(piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol (PubChem CID 146424232) has the molecular formula C13H23N3OS
and a molecular weight of 269.41 g/mol. Its IUPAC name is (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol.
Molecular Properties
| Compound Name | (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol |
| PubChem CID | 146424232 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol |
| SMILES | CC(C)c1cc(C(O)NCC2CCNCC2)ns1 |
| InChI | InChI=1S/C13H23N3OS/c1-9(2)12-7-11(16-18-12)13(17)15-8-10-3-5-14-6-4-10/h7,9-10,13-15,17H,3-6,8H2,1-2H3 |
| InChIKey | OVEZLZGBSRDJGQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol?
The IUPAC name of (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol (CID 146424232) is (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol.
What is the SMILES notation for (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol?
The canonical SMILES for (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol is CC(C)c1cc(C(O)NCC2CCNCC2)ns1.
What is the InChIKey of (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol?
The InChIKey is OVEZLZGBSRDJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3OS/c1-9(2)12-7-11(16-18-12)13(17)15-8-10-3-5-14-6-4-10/h7,9-10,13-15,17H,3-6,8H2,1-2H3.
What are the key properties of (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol?
(piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol has a molecular weight of 269.41 g/mol, XLogP of 1.85, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (piperidin-4-ylmethylamino)-(5-propan-2-yl-1,2-thiazol-3-yl)methanol is sourced from PubChem (CID 146424232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).