C26H42N4 — CID 146424405
(E)-N'-[(2R)-2,3-dimethylbut-3-enyl]-2-methyl-3-[4-[(3Z)-4-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)buta-1,3-dien-2-yl]piperidin-1-yl]but-2-enimidamide (PubChem CID 146424405) has the molecular formula C26H42N4 and a molecular weight of 410.65 g/mol. Its IUPAC name is (E)-N'-[(2R)-2,3-dimethylbut-3-enyl]-2-methyl-3-[4-[(3Z)-4-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)buta-1,3-dien-2-yl]piperidin-1-yl]but-2-enimidamide.
| Compound Name | (E)-N'-[(2R)-2,3-dimethylbut-3-enyl]-2-methyl-3-[4-[(3Z)-4-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)buta-1,3-dien-2-yl]piperidin-1-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 146424405 |
| Molecular Formula | C26H42N4 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | (E)-N'-[(2R)-2,3-dimethylbut-3-enyl]-2-methyl-3-[4-[(3Z)-4-(6-methyl-1,2,3,4-tetrahydropyridin-5-yl)buta-1,3-dien-2-yl]piperidin-1-yl]but-2-enimidamide |
| SMILES | C=C(/C=C\C1=C(C)NCCC1)C1CCN(/C(C)=C(C)/C(N)=N/C[C@H](C)C(=C)C)CC1 |
| InChI | InChI=1S/C26H42N4/c1-18(2)20(4)17-29-26(27)21(5)23(7)30-15-12-24(13-16-30)19(3)10-11-25-9-8-14-28-22(25)6/h10-11,20,24,28H,1,3,8-9,12-17H2,2,4-7H3,(H2,27,29)/b11-10-,23-21+/t20-/m0/s1 |
| InChIKey | DUWBALRLAMDBGJ-QERGAVOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|