C11H17N3 — CID 146424567
2-(3-ethylpiperidin-1-yl)pyrazine (PubChem CID 146424567) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-(3-ethylpiperidin-1-yl)pyrazine.
| Compound Name | 2-(3-ethylpiperidin-1-yl)pyrazine |
|---|---|
| PubChem CID | 146424567 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-(3-ethylpiperidin-1-yl)pyrazine |
| SMILES | CCC1CCCN(c2cnccn2)C1 |
| InChI | InChI=1S/C11H17N3/c1-2-10-4-3-7-14(9-10)11-8-12-5-6-13-11/h5-6,8,10H,2-4,7,9H2,1H3 |
| InChIKey | LWOLDEKCHGKIGB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |