C16H15N3O4S — CID 146424583
7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 146424583) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 146424583 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-2-pyridin-2-yl-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | C[C@H]1O[C@@H](c2csc3c(=O)[nH]c(-c4ccccn4)nc23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H15N3O4S/c1-7-11(20)12(21)13(23-7)8-6-24-14-10(8)18-15(19-16(14)22)9-4-2-3-5-17-9/h2-7,11-13,20-21H,1H3,(H,18,19,22)/t7-,11-,12-,13+/m1/s1 |
| InChIKey | MGFCRXAHKBVEGV-YAUNCSCZSA-N |
| XLogP | 1.23 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |