About 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole
4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole (PubChem CID 146424964) has the molecular formula C10H5F6N3
and a molecular weight of 281.16 g/mol. Its IUPAC name is 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole.
Molecular Properties
| Compound Name | 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole |
| PubChem CID | 146424964 |
| Molecular Formula | C10H5F6N3 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole |
| SMILES | FC(F)(F)c1ccc(-c2cn[nH]n2)cc1C(F)(F)F |
| InChI | InChI=1S/C10H5F6N3/c11-9(12,13)6-2-1-5(8-4-17-19-18-8)3-7(6)10(14,15)16/h1-4H,(H,17,18,19) |
| InChIKey | UIKFEFNTRSCIII-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole?
The IUPAC name of 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole (CID 146424964) is 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole.
What is the SMILES notation for 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole?
The canonical SMILES for 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole is FC(F)(F)c1ccc(-c2cn[nH]n2)cc1C(F)(F)F.
What is the InChIKey of 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole?
The InChIKey is UIKFEFNTRSCIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F6N3/c11-9(12,13)6-2-1-5(8-4-17-19-18-8)3-7(6)10(14,15)16/h1-4H,(H,17,18,19).
What are the key properties of 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole?
4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole has a molecular weight of 281.16 g/mol, XLogP of 3.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,4-bis(trifluoromethyl)phenyl]-2H-triazole is sourced from PubChem (CID 146424964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).