C13H21N3O3 — CID 146425012
N-propan-2-ylprop-2-enamide;N-[(prop-2-enoylamino)methyl]prop-2-enamide (PubChem CID 146425012) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N-propan-2-ylprop-2-enamide;N-[(prop-2-enoylamino)methyl]prop-2-enamide.
| Compound Name | N-propan-2-ylprop-2-enamide;N-[(prop-2-enoylamino)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 146425012 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N-propan-2-ylprop-2-enamide;N-[(prop-2-enoylamino)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)C.C=CC(=O)NCNC(=O)C=C |
| InChI | InChI=1S/C7H10N2O2.C6H11NO/c1-3-6(10)8-5-9-7(11)4-2;1-4-6(8)7-5(2)3/h3-4H,1-2,5H2,(H,8,10)(H,9,11);4-5H,1H2,2-3H3,(H,7,8) |
| InChIKey | UOZCJNVMVXCXFI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|