About 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine
4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine (PubChem CID 146425110) has the molecular formula C10H11Cl2FN2O
and a molecular weight of 265.11 g/mol. Its IUPAC name is 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine.
Molecular Properties
| Compound Name | 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine |
| PubChem CID | 146425110 |
| Molecular Formula | C10H11Cl2FN2O |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine |
| SMILES | Fc1c(CN2CCOCC2)cc(Cl)nc1Cl |
| InChI | InChI=1S/C10H11Cl2FN2O/c11-8-5-7(9(13)10(12)14-8)6-15-1-3-16-4-2-15/h5H,1-4,6H2 |
| InChIKey | AFNDZPDDTHHDLU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine?
The IUPAC name of 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine (CID 146425110) is 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine.
What is the SMILES notation for 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine?
The canonical SMILES for 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine is Fc1c(CN2CCOCC2)cc(Cl)nc1Cl.
What is the InChIKey of 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine?
The InChIKey is AFNDZPDDTHHDLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2FN2O/c11-8-5-7(9(13)10(12)14-8)6-15-1-3-16-4-2-15/h5H,1-4,6H2.
What are the key properties of 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine?
4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine has a molecular weight of 265.11 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dichloro-3-fluoro-4-pyridinyl)methyl]morpholine is sourced from PubChem (CID 146425110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).