C15H20F3N3O5S2 — CID 146425135
tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate (PubChem CID 146425135) has the molecular formula C15H20F3N3O5S2 and a molecular weight of 443.47 g/mol. Its IUPAC name is tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate.
| Compound Name | tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate |
|---|---|
| PubChem CID | 146425135 |
| Molecular Formula | C15H20F3N3O5S2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | tert-butyl 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylate |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C15H20F3N3O5S2/c1-14(2,3)25-13(22)21-7-5-6-9-10(8-21)19-12(27-4)20-11(9)26-28(23,24)15(16,17)18/h5-8H2,1-4H3 |
| InChIKey | MDMWDBBKLYHLPL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|