C11H12F3N3O5S2 — CID 146425165
2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylic acid (PubChem CID 146425165) has the molecular formula C11H12F3N3O5S2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylic acid.
| Compound Name | 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylic acid |
|---|---|
| PubChem CID | 146425165 |
| Molecular Formula | C11H12F3N3O5S2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-methylsulfanyl-4-(trifluoromethylsulfonyloxy)-5,6,7,9-tetrahydropyrimido[4,5-c]azepine-8-carboxylic acid |
| SMILES | CSc1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCCN(C(=O)O)C2 |
| InChI | InChI=1S/C11H12F3N3O5S2/c1-23-9-15-7-5-17(10(18)19)4-2-3-6(7)8(16-9)22-24(20,21)11(12,13)14/h2-5H2,1H3,(H,18,19) |
| InChIKey | TZVAMAAUQCBWKH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|