About 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol
2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol (PubChem CID 146425268) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol |
| PubChem CID | 146425268 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol |
| SMILES | CN1C=CCN(C)C1CCO |
| InChI | InChI=1S/C8H16N2O/c1-9-5-3-6-10(2)8(9)4-7-11/h3,5,8,11H,4,6-7H2,1-2H3 |
| InChIKey | NNSHBBYIUZZESJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol?
The IUPAC name of 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol (CID 146425268) is 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol.
What is the SMILES notation for 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol?
The canonical SMILES for 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol is CN1C=CCN(C)C1CCO.
What is the InChIKey of 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol?
The InChIKey is NNSHBBYIUZZESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-9-5-3-6-10(2)8(9)4-7-11/h3,5,8,11H,4,6-7H2,1-2H3.
What are the key properties of 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol?
2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol has a molecular weight of 156.23 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,4-dihydropyrimidin-2-yl)ethanol is sourced from PubChem (CID 146425268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).